Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 111652-20-1)?

Answer

2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate
2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate is a colorless to white crystalline solid with a molecular weight of approximately 408.48 g/mol. It has a melting point of 150-152°C and a solubility of 0.012 g/100 mL in water at 20°C. This compound is known for its low reactivity under normal conditions, but it may undergo hydrolysis in basic or acidic solutions.

About

English Name 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate
Molecular Formula C11H21NO4
Molecular Weight 231.29 g/mol
SMILES CC(C)(C)OC(=O)CNC(=O)OC(C)(C)C
InChIKey ZDKFMHKWZATBMR-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 111652-20-1) typically synthesized?

2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate can be synthesized through the r...

Compound Q&A

What industries use 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 111652-20-1)?

2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 111652-20-1)?

When handling 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate, it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...