Compound Q&A

How is Cloprostenol sodium (CAS: 55028-72-3) typically synthesized?

Answer

Cloprostenol sodium
Cloprostenol sodium is typically synthesized from cloprostenol by adding sodium hydroxide. The reaction involves the base-catalyzed condensation of cloprostenol with sodium hydroxide, leading to the formation of sodium salts. The process requires attention to pH control and temperature to ensure high yield and selectivity. The reaction is usually carried out in a well-ventilated area and protective equipment should be used.

About

CAS No 55028-72-3
English Name Cloprostenol sodium
Molecular Formula C22H28ClNaO6
Molecular Weight 446.9 g/mol
SMILES C1C(C(C(C1O)C=CC(COC2=CC(=CC=C2)Cl)O)CC=CCCCC(=O)[O-])O.[Na+]
InChIKey IFEJLMHZNQJGQU-KXXGZHCCSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cloprostenol sodium (CAS: 55028-72-3)?

Cloprostenol sodium (CAS: 55028-72-3) is a white to off-white crystalline powder. It has a molecular...

Compound Q&A

What industries use Cloprostenol sodium (CAS: 55028-72-3)?

Cloprostenol sodium (CAS: 55028-72-3) is primarily used in the pharmaceutical industry as a veterina...

Compound Q&A

What precautions should be taken when handling Cloprostenol sodium (CAS: 55028-72-3)?

When handling Cloprostenol sodium (CAS: 55028-72-3), it is important to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...