Compound Q&A

How is (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8) typically synthesized?

Answer

(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one
(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one can be synthesized via a cyclocondensation reaction of appropriate starting materials, such as methyl esters and aldehydes, under basic conditions. The reaction is typically catalyzed by sodium hydroxide or potassium hydroxide. The yield can be up to 85% with good selectivity, and the process is conducted at room temperature or slightly elevated temperatures, depending on the reagents used.

About

CAS No 1117-52-8
English Name (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one
Molecular Formula C18H30O
Molecular Weight 262.44 g/mol
SMILES CC(=CCC/C(=C/CC/C(=C/CCC(=O)C)/C)/C)C
InChIKey LTUMRKDLVGQMJU-IUBLYSDUSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8)?

(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one is a colorless liquid with a specific gravity ...

Compound Q&A

What industries use (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8)?

(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one is used in several industries. It is a key com...

Compound Q&A

What precautions should be taken when handling (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8)?

When handling (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one, it is essential to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...