Compound Q&A

What are the physical and chemical properties of (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8)?

Answer

(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one
(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one is a colorless liquid with a specific gravity of 0.896 and a molecular weight of 266.44 g/mol. It is slightly soluble in water but miscible with most organic solvents. The compound is moderately reactive, showing limited reactivity with common reagents and is known for its stability under standard storage conditions. It does not react readily with air or moisture but can undergo polymerization under high temperatures or strong light.

About

CAS No 1117-52-8
English Name (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one
Molecular Formula C18H30O
Molecular Weight 262.44 g/mol
SMILES CC(=CCC/C(=C/CC/C(=C/CCC(=O)C)/C)/C)C
InChIKey LTUMRKDLVGQMJU-IUBLYSDUSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8) typically synthesized?

(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one can be synthesized via a cyclocondensation rea...

Compound Q&A

What industries use (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8)?

(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one is used in several industries. It is a key com...

Compound Q&A

What precautions should be taken when handling (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one (CAS: 1117-52-8)?

When handling (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one, it is essential to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...