Compound Q&A

How is Piperazine citrate (CAS: 144-29-6) typically synthesized?

Answer

Piperazine citrate
Piperazine citrate can be synthesized by reacting piperazine with citric acid. The reaction involves the formation of a salt between piperazine and citric acid. Commonly, this process is carried out in aqueous solution at room temperature. The yield is typically high, with a selectivity towards the desired product, and the process is straightforward without the need for complex catalysts.

About

CAS No 144-29-6
English Name Piperazine citrate
Molecular Formula C24H46N6O14
Molecular Weight 278.26 g/mol
EINECS 205-622-8
SMILES OC(C(O)=O)(CC(O)=O)CC(O)=O.N1CCNCC1
InChIKey SWDXALWLRYIJHK-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Piperazine citrate (CAS: 144-29-6)?

Piperazine citrate is a white crystalline solid with a molecular weight of approximately 252.27 g/mo...

Compound Q&A

What industries use Piperazine citrate (CAS: 144-29-6)?

Piperazine citrate is utilized in various industries. In the pharmaceutical industry, it serves as a...

Compound Q&A

What precautions should be taken when handling Piperazine citrate (CAS: 144-29-6)?

When handling Piperazine citrate, it is important to use personal protective equipment (PPE), such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...