Compound Q&A

What precautions should be taken when handling 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7)?

Answer

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid
When handling 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7), it is recommended to use appropriate personal protective equipment (PPE) such as gloves and safety goggles. The compound should be stored in a cool, dry place away from direct sunlight. In case of spills, ensure proper ventilation and use suitable absorbents. For detailed safety information, refer to the Material Safety Data Sheet (MSDS).

About

CAS No 22910-60-7
English Name 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid
Molecular Formula C22H34O3
Molecular Weight 346.51 g/mol
SMILES CCCCCCC=CCCCCCCCC1=C(C(=CC=C1)O)C(=O)O
InChIKey YXHVCZZLWZYHSA-FPLPWBNLSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7)?

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) has a crystalline form with a mol...

Compound Q&A

How is 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) typically synthesized?

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) is typically synthesized via a co...

Compound Q&A

What industries use 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7)?

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) finds applications in the pharmac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...