Compound Q&A

What industries use 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7)?

Answer

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid
2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) finds applications in the pharmaceutical industry for synthesizing active pharmaceutical ingredients. It is also used in the polymer industry as a monomer for developing new polymer materials. Additionally, it can be utilized in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 22910-60-7
English Name 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid
Molecular Formula C22H34O3
Molecular Weight 346.51 g/mol
SMILES CCCCCCC=CCCCCCCCC1=C(C(=CC=C1)O)C(=O)O
InChIKey YXHVCZZLWZYHSA-FPLPWBNLSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7)?

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) has a crystalline form with a mol...

Compound Q&A

How is 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) typically synthesized?

2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7) is typically synthesized via a co...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7)?

When handling 2-Hydroxy-6-[(8Z)-8-pentadecen-1-yl]benzoic acid (CAS: 22910-60-7), it is recommended ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...