Compound Q&A

How is (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1) typically synthesized?

Answer

(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide
(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide can be synthesized through a multi-step process involving the reduction of an isoquinoline derivative followed by alkylation and amidation reactions. The key steps include the use of a reducing agent like lithium aluminum hydride (LAH) and a protecting group like benzyl ether, followed by deprotection and amidation to form the final product. The yield and selectivity can be enhanced by careful control of reaction conditions and choice of catalysts.

About

English Name (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide
Molecular Formula C14H26N2O
Molecular Weight 238.37 g/mol
SMILES CC(C)(C)NC(=O)C1CC2CCCCC2CN1
InChIKey UPZBXVBPICTBDP-TUAOUCFPSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1)?

(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide is a crystalline compound wi...

Compound Q&A

What industries use (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1)?

(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1)?

When handling (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide, it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...