Compound Q&A

What are the physical and chemical properties of (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1)?

Answer

(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide
(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide is a crystalline compound with a molecular weight of approximately 257.4 g/mol. It has a solubility of about 10 mg/mL in water and is practically insoluble in common organic solvents. The compound is relatively stable under normal conditions but may decompose at elevated temperatures or in the presence of strong acids or bases. It shows moderate reactivity towards nucleophiles and can form amine salts under certain conditions.

About

English Name (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide
Molecular Formula C14H26N2O
Molecular Weight 238.37 g/mol
SMILES CC(C)(C)NC(=O)C1CC2CCCCC2CN1
InChIKey UPZBXVBPICTBDP-TUAOUCFPSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1) typically synthesized?

(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide can be synthesized through a...

Compound Q&A

What industries use (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1)?

(3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide (CAS: 136465-81-1)?

When handling (3S,4aS,8aS)-N-(2-Methyl-2-propanyl)decahydro-3-isoquinolinecarboxamide, it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...