Compound Q&A

What industries use Detomidine Hydrochloride (CAS: 90038-01-0)?

Answer

Detomidine Hydrochloride
Detomidine Hydrochloride is primarily used in the pharmaceutical industry for veterinary applications, particularly as an anesthetic. It is also used in research for pharmacological studies. Its use in manufacturing animal health products and veterinary medicines is widespread.

About

CAS No 90038-01-0
English Name Detomidine Hydrochloride
Molecular Formula C12H15ClN2
Molecular Weight 222.72 g/mol
SMILES CC1=C(C(=CC=C1)CC2=CN=CN2)C.Cl
InChIKey OIWRDXKNDCJZSM-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Detomidine Hydrochloride (CAS: 90038-01-0)?

Detomidine Hydrochloride is a crystalline compound with a molecular weight of approximately 469.86 g...

Compound Q&A

How is Detomidine Hydrochloride (CAS: 90038-01-0) typically synthesized?

Detomidine Hydrochloride is synthesized via a multi-step process involving condensation reactions, h...

Compound Q&A

What precautions should be taken when handling Detomidine Hydrochloride (CAS: 90038-01-0)?

Handling Detomidine Hydrochloride requires appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...