Compound Q&A

What are the physical and chemical properties of Detomidine Hydrochloride (CAS: 90038-01-0)?

Answer

Detomidine Hydrochloride
Detomidine Hydrochloride is a crystalline compound with a molecular weight of approximately 469.86 g/mol. It is slightly soluble in water and sparingly soluble in ethanol. Chemically, it is highly reactive under basic conditions and relatively stable under acidic conditions.

About

CAS No 90038-01-0
English Name Detomidine Hydrochloride
Molecular Formula C12H15ClN2
Molecular Weight 222.72 g/mol
SMILES CC1=C(C(=CC=C1)CC2=CN=CN2)C.Cl
InChIKey OIWRDXKNDCJZSM-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Detomidine Hydrochloride (CAS: 90038-01-0) typically synthesized?

Detomidine Hydrochloride is synthesized via a multi-step process involving condensation reactions, h...

Compound Q&A

What industries use Detomidine Hydrochloride (CAS: 90038-01-0)?

Detomidine Hydrochloride is primarily used in the pharmaceutical industry for veterinary application...

Compound Q&A

What precautions should be taken when handling Detomidine Hydrochloride (CAS: 90038-01-0)?

Handling Detomidine Hydrochloride requires appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...