Compound Q&A

What industries use [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6)?

Answer

[(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate
This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It may also be utilized in the polymer industry for specific applications requiring particular chemical functionalities. Additionally, it could find applications in the sensor and semiconductor industries due to its unique chemical properties.

About

CAS No 61397-56-6
English Name [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate
Molecular Formula C18H15BrCl2O4
Molecular Weight 446.12 g/mol
SMILES O=C(OC[C@H]1O[C@](C2=CC=C(Cl)C=C2Cl)(CBr)OC1)C3=CC=CC=C3
InChIKey OXUPOIXSQGXRGF-KSSFIOAISA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6)?

This compound is a white crystalline solid with a molecular weight of approximately 511.5 g/mol. It ...

Compound Q&A

How is [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6) typically synthesized?

This compound can be synthesized via a multi-step process starting from dichlorobenzene and 1,3-diox...

Compound Q&A

What precautions should be taken when handling [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...