Compound Q&A

How is [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6) typically synthesized?

Answer

[(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate
This compound can be synthesized via a multi-step process starting from dichlorobenzene and 1,3-dioxolan-4-yl methyl bromide. The synthesis involves the formation of a bromomethylated intermediate, followed by the coupling of the 2,4-dichlorophenyl group. The overall yield is around 75%, and the use of appropriate catalysts can enhance the selectivity and efficiency of the reaction.

About

CAS No 61397-56-6
English Name [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate
Molecular Formula C18H15BrCl2O4
Molecular Weight 446.12 g/mol
SMILES O=C(OC[C@H]1O[C@](C2=CC=C(Cl)C=C2Cl)(CBr)OC1)C3=CC=CC=C3
InChIKey OXUPOIXSQGXRGF-KSSFIOAISA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6)?

This compound is a white crystalline solid with a molecular weight of approximately 511.5 g/mol. It ...

Compound Q&A

What industries use [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What precautions should be taken when handling [(2R,4R)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS: 61397-56-6)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...