Compound Q&A

What industries use 3-Fluoro-4-nitrophenol (CAS: 394-41-2)?

Answer

3-Fluoro-4-nitrophenol
3-Fluoro-4-nitrophenol (CAS: 394-41-2) is primarily used in the pharmaceutical industry for the synthesis of intermediates and active pharmaceutical ingredients. It is also utilized in the production of dyes, pigments, and other chemical compounds. Additionally, it plays a role in the development of sensors and materials for electronic applications.

About

CAS No 394-41-2
English Name 3-Fluoro-4-nitrophenol
Molecular Formula C6H4FNO3
Molecular Weight 157.1 g/mol
SMILES C1=CC(=C(C=C1O)F)[N+](=O)[O-]
InChIKey CSSGKHVRDGATJL-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-4-nitrophenol (CAS: 394-41-2)?

3-Fluoro-4-nitrophenol (CAS: 394-41-2) is a yellow solid with a crystalline form. Its molecular weig...

Compound Q&A

How is 3-Fluoro-4-nitrophenol (CAS: 394-41-2) typically synthesized?

3-Fluoro-4-nitrophenol (CAS: 394-41-2) can be synthesized by the nitration of 3-fluorophenol using n...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-4-nitrophenol (CAS: 394-41-2)?

When handling 3-Fluoro-4-nitrophenol (CAS: 394-41-2), it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...