Compound Q&A

How is 3-Fluoro-4-nitrophenol (CAS: 394-41-2) typically synthesized?

Answer

3-Fluoro-4-nitrophenol
3-Fluoro-4-nitrophenol (CAS: 394-41-2) can be synthesized by the nitration of 3-fluorophenol using nitric acid and sulfuric acid as reagents. The process involves the sequential introduction of nitro groups. Commonly, a mixture of 3-fluorophenol and concentrated nitric acid is heated to achieve the desired product, with careful monitoring of temperature and reaction progress to ensure high selectivity and yield.

About

CAS No 394-41-2
English Name 3-Fluoro-4-nitrophenol
Molecular Formula C6H4FNO3
Molecular Weight 157.1 g/mol
SMILES C1=CC(=C(C=C1O)F)[N+](=O)[O-]
InChIKey CSSGKHVRDGATJL-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-4-nitrophenol (CAS: 394-41-2)?

3-Fluoro-4-nitrophenol (CAS: 394-41-2) is a yellow solid with a crystalline form. Its molecular weig...

Compound Q&A

What industries use 3-Fluoro-4-nitrophenol (CAS: 394-41-2)?

3-Fluoro-4-nitrophenol (CAS: 394-41-2) is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-4-nitrophenol (CAS: 394-41-2)?

When handling 3-Fluoro-4-nitrophenol (CAS: 394-41-2), it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...