Compound Q&A

How is 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) typically synthesized?

Answer

4-Amino-1-naphthalenesulfonic Acid
4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) is typically synthesized through the sulfonation of naphthalene followed by the coupling with aniline. Common catalysts include sulfuric acid, and the process involves multiple steps such as sulfonation, coupling, and purification to achieve high yield and selectivity.

About

CAS No 84-86-6
English Name 4-Amino-1-naphthalenesulfonic Acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)O)N
InChIKey NRZRRZAVMCAKEP-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6)?

4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) is a crystalline compound with a molecular weight ...

Compound Q&A

What industries use 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6)?

4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) is utilized in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6)?

When handling 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...