Compound Q&A

What are the physical and chemical properties of 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6)?

Answer

4-Amino-1-naphthalenesulfonic Acid
4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) is a crystalline compound with a molecular weight of approximately 208.16 g/mol. It is slightly soluble in water and more soluble in organic solvents. The compound is known for its reactivity towards acidic and basic conditions, making it useful in various analytical and industrial applications.

About

CAS No 84-86-6
English Name 4-Amino-1-naphthalenesulfonic Acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)O)N
InChIKey NRZRRZAVMCAKEP-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) typically synthesized?

4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) is typically synthesized through the sulfonation o...

Compound Q&A

What industries use 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6)?

4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6) is utilized in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6)?

When handling 4-Amino-1-naphthalenesulfonic Acid (CAS: 84-86-6), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...