Compound Q&A

What precautions should be taken when handling 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4)?

Answer

1,3-Dimesitylimidazolidin-1-ium chloride
When handling 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4), it is important to use personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be carried out in a fume hood. Spills should be cleaned up using appropriate materials and procedures. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 1,3-Dimesitylimidazolidin-1-ium chloride
Molecular Formula C21H29ClN2
Molecular Weight 342.9 g/mol
SMILES CC1=CC(=C(C(=C1)C)N2CC[N+](=C2)C3=C(C=C(C=C3C)C)C)C.[Cl-]
InChIKey HOOKQVAAJVEFHV-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4)?

1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) is a crystalline compound with a molecul...

Compound Q&A

How is 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) typically synthesized?

1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) is typically synthesized by reacting 1,3...

Compound Q&A

What industries use 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4)?

1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) is used in pharmaceuticals for the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...