Compound Q&A

What are the physical and chemical properties of 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4)?

Answer

1,3-Dimesitylimidazolidin-1-ium chloride
1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) is a crystalline compound with a molecular weight of approximately 474.44 g/mol. It has a high solubility in organic solvents such as dimethylformamide and dimethyl sulfoxide. Chemically, it is stable under normal conditions but can react with strong bases. It is often used in organic synthesis and as a protonic acid in various applications.

About

English Name 1,3-Dimesitylimidazolidin-1-ium chloride
Molecular Formula C21H29ClN2
Molecular Weight 342.9 g/mol
SMILES CC1=CC(=C(C(=C1)C)N2CC[N+](=C2)C3=C(C=C(C=C3C)C)C)C.[Cl-]
InChIKey HOOKQVAAJVEFHV-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) typically synthesized?

1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) is typically synthesized by reacting 1,3...

Compound Q&A

What industries use 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4)?

1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4) is used in pharmaceuticals for the synth...

Compound Q&A

What precautions should be taken when handling 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4)?

When handling 1,3-Dimesitylimidazolidin-1-ium chloride (CAS: 173035-10-4), it is important to use pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...