Compound Q&A

What precautions should be taken when handling 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7)?

Answer

3,6-Dichloro-4-pyridazinecarboxylic acid
When handling 3,6-Dichloro-4-pyridazinecarboxylic acid, it is essential to use proper personal protective equipment (PPE), including gloves, goggles, and a lab coat. This compound should be stored in a cool, dry place away from heat sources and direct sunlight. It should be handled under a fume hood to minimize inhalation risk. In case of a spill, immediately contain it and clean up using appropriate absorbents. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 51149-08-7
English Name 3,6-Dichloro-4-pyridazinecarboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=C(C(=NN=C1Cl)Cl)C(=O)O
InChIKey FRCXPDWDMAYSCE-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7)?

3,6-Dichloro-4-pyridazinecarboxylic acid is a white to off-white crystalline solid with a molecular ...

Compound Q&A

How is 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7) typically synthesized?

3,6-Dichloro-4-pyridazinecarboxylic acid is typically synthesized via the reaction of 4-chloropyrida...

Compound Q&A

What industries use 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7)?

3,6-Dichloro-4-pyridazinecarboxylic acid finds applications primarily in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...