Compound Q&A

What are the physical and chemical properties of 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7)?

Answer

3,6-Dichloro-4-pyridazinecarboxylic acid
3,6-Dichloro-4-pyridazinecarboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 226.03 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is relatively stable under normal conditions but can react with strong bases to form salts. It is insoluble in water, soluble in ethanol, and slightly soluble in acetone.

About

CAS No 51149-08-7
English Name 3,6-Dichloro-4-pyridazinecarboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=C(C(=NN=C1Cl)Cl)C(=O)O
InChIKey FRCXPDWDMAYSCE-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7) typically synthesized?

3,6-Dichloro-4-pyridazinecarboxylic acid is typically synthesized via the reaction of 4-chloropyrida...

Compound Q&A

What industries use 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7)?

3,6-Dichloro-4-pyridazinecarboxylic acid finds applications primarily in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 3,6-Dichloro-4-pyridazinecarboxylic acid (CAS: 51149-08-7)?

When handling 3,6-Dichloro-4-pyridazinecarboxylic acid, it is essential to use proper personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...