Compound Q&A

What are the physical and chemical properties of 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2)?

Answer

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid
2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) is a white to off-white crystalline solid. It has a molecular weight of approximately 445.5 g/mol. This compound is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is moderately reactive and susceptible to hydrolysis under acidic or basic conditions.

About

CAS No 54574-82-2
English Name 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid
Molecular Formula C22H27NO4
Molecular Weight 369.4610000000001 g/mol
SMILES CCCCN(CCCC)C1=CC(=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)O
InChIKey QPNFUBAIQZJEPO-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) typically synthesized?

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) is typically synthesized via car...

Compound Q&A

What industries use 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2)?

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2)?

When handling 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2), wear appropriate ...

Compound Q&A

Is 4-Anilino-1H-1,2,3-triazole-5-carboxylic acid (CAS: 72693-60-8) safe?

4-Anilino-1H-1,2,3-triazole-5-carboxylic acid is generally considered safe when ...

72693-60-84-Anilino-1H-1,2,3-t...
Compound Q&A

How should waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) be handled?

Waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) should...

933697-27-92-(2-Aminoethyl)-1H-...
Compound Q&A

How is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride (CAS: 38059-78-8) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride is t...

38059-78-84-Amino-5-chloro-N-[...
Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8)?

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8) is primarily...

92152-60-82-(4-Bromophenyl)-1-...