Compound Q&A

What precautions should be taken when handling 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2)?

Answer

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid
When handling 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2), wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat. Work in a well-ventilated area or fume hood to prevent inhalation. Spills should be cleaned up immediately with appropriate absorbent materials. Refer to the safety data sheet (SDS) for detailed handling and storage instructions.

About

CAS No 54574-82-2
English Name 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid
Molecular Formula C22H27NO4
Molecular Weight 369.4610000000001 g/mol
SMILES CCCCN(CCCC)C1=CC(=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)O
InChIKey QPNFUBAIQZJEPO-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2)?

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) is a white to off-white crystall...

Compound Q&A

How is 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) typically synthesized?

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) is typically synthesized via car...

Compound Q&A

What industries use 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2)?

2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS: 54574-82-2) finds applications in the pharma...

Compound Q&A

What is 2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0)?

2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0) is a benzoic acid derivativ...

16611-84-02-Hydroxy-6-pentadec...
Compound Q&A

What are the main uses of 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4) is primarily use...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)?

1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)...

105637-50-11-[(5-Chloro-1-napht...
Compound Q&A

What regulatory guidelines apply to 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6)?

1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6) is regulated u...

28523-86-61,1,1,3,3,3-Hexafluo...