Compound Q&A

What industries use 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3)?

Answer

2,3,5-Trichloro-6-hydroxybenzoic acid
2,3,5-Trichloro-6-hydroxybenzoic acid finds applications in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the polymer industry for modifying properties of polymers. Additionally, it has applications in the production of sensors and in semiconductor technology due to its specific chemical characteristics and reactivity.

About

CAS No 40932-60-3
English Name 2,3,5-Trichloro-6-hydroxybenzoic acid
Molecular Formula C7H3Cl3O3
Molecular Weight 241.46 g/mol
SMILES C1=C(C(=C(C(=C1Cl)Cl)C(=O)O)O)Cl
InChIKey IIHCUZVBIMTHEB-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3)?

2,3,5-Trichloro-6-hydroxybenzoic acid is a solid compound with a crystalline form. Its molecular wei...

Compound Q&A

How is 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3) typically synthesized?

2,3,5-Trichloro-6-hydroxybenzoic acid can be synthesized via the chlorination of 6-hydroxybenzoic ac...

Compound Q&A

What precautions should be taken when handling 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3)?

When handling 2,3,5-Trichloro-6-hydroxybenzoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...