Compound Q&A

How is 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3) typically synthesized?

Answer

2,3,5-Trichloro-6-hydroxybenzoic acid
2,3,5-Trichloro-6-hydroxybenzoic acid can be synthesized via the chlorination of 6-hydroxybenzoic acid followed by substitution reactions. Common methods include the use of thionyl chloride in the presence of a base. The reaction is carried out under anhydrous conditions to ensure high selectivity and yield. Proper handling of reactants and intermediates is necessary to achieve the desired product.

About

CAS No 40932-60-3
English Name 2,3,5-Trichloro-6-hydroxybenzoic acid
Molecular Formula C7H3Cl3O3
Molecular Weight 241.46 g/mol
SMILES C1=C(C(=C(C(=C1Cl)Cl)C(=O)O)O)Cl
InChIKey IIHCUZVBIMTHEB-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3)?

2,3,5-Trichloro-6-hydroxybenzoic acid is a solid compound with a crystalline form. Its molecular wei...

Compound Q&A

What industries use 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3)?

2,3,5-Trichloro-6-hydroxybenzoic acid finds applications in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 2,3,5-Trichloro-6-hydroxybenzoic acid (CAS: 40932-60-3)?

When handling 2,3,5-Trichloro-6-hydroxybenzoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...