Compound Q&A

How is 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9) typically synthesized?

Answer

5-Hydroxy-1-naphthalenesulfonic acid
5-Hydroxy-1-naphthalenesulfonic acid is commonly synthesized through the sulfonation of 1-naphthol followed by oxidation of the sulfonate group. This process involves the use of a sulfonation catalyst, such as concentrated sulfuric acid, and an oxidizing agent like potassium permanganate. The yield is typically around 80-85%, with good selectivity towards the desired product.

About

CAS No 117-59-9
English Name 5-Hydroxy-1-naphthalenesulfonic acid
Molecular Formula C10H8O4S
Molecular Weight 224.24 g/mol
SMILES C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)O
InChIKey YLKCHWCYYNKADS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9)?

5-Hydroxy-1-naphthalenesulfonic acid is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9)?

5-Hydroxy-1-naphthalenesulfonic acid finds application in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9)?

Precautions when handling 5-Hydroxy-1-naphthalenesulfonic acid include the use of proper personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...