Compound Q&A

What are the physical and chemical properties of 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9)?

Answer

5-Hydroxy-1-naphthalenesulfonic acid
5-Hydroxy-1-naphthalenesulfonic acid is a crystalline compound with a molecular weight of approximately 212.21 g/mol. It has a low solubility in water, around 2.5 g/L at 20°C. Chemically, it exhibits basic properties and can react with acids to form salts. It is stable under normal conditions but may undergo hydrolysis in the presence of strong bases.

About

CAS No 117-59-9
English Name 5-Hydroxy-1-naphthalenesulfonic acid
Molecular Formula C10H8O4S
Molecular Weight 224.24 g/mol
SMILES C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)O
InChIKey YLKCHWCYYNKADS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9) typically synthesized?

5-Hydroxy-1-naphthalenesulfonic acid is commonly synthesized through the sulfonation of 1-naphthol f...

Compound Q&A

What industries use 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9)?

5-Hydroxy-1-naphthalenesulfonic acid finds application in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 5-Hydroxy-1-naphthalenesulfonic acid (CAS: 117-59-9)?

Precautions when handling 5-Hydroxy-1-naphthalenesulfonic acid include the use of proper personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...