Compound Q&A

What industries use 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4)?

Answer

4-tert-Butylcyclohexyl acetate
4-tert-Butylcyclohexyl acetate is primarily used in the fragrance and flavor industry due to its pleasant fruity aroma. It is also used in the personal care industry as a fragrance additive. Additionally, it can be found in some pharmaceutical products and as a chemical intermediate in industrial applications.

About

CAS No 32210-23-4
English Name 4-tert-Butylcyclohexyl acetate
Molecular Formula C12H22O2
Molecular Weight 198.3 g/mol
EINECS 250-954-9
SMILES CC(=O)OC1CCC(CC1)C(C)(C)C
InChIKey MBZRJSQZCBXRGK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4)?

4-tert-Butylcyclohexyl acetate is a colorless to light yellow liquid with a fruity odor. It has a mo...

Compound Q&A

How is 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4) typically synthesized?

4-tert-Butylcyclohexyl acetate is typically synthesized by the esterification of acetic acid with te...

Compound Q&A

What precautions should be taken when handling 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4)?

When handling 4-tert-Butylcyclohexyl acetate, proper personal protective equipment (PPE) should be w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...