Compound Q&A

How is 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4) typically synthesized?

Answer

4-tert-Butylcyclohexyl acetate
4-tert-Butylcyclohexyl acetate is typically synthesized by the esterification of acetic acid with tert-butylcyclohexanol in the presence of a strong acid catalyst, such as sulfuric acid. The reaction is performed at elevated temperatures, and water is removed to drive the reaction to completion. The yield is generally around 85-90%, and the product is purified by distillation.

About

CAS No 32210-23-4
English Name 4-tert-Butylcyclohexyl acetate
Molecular Formula C12H22O2
Molecular Weight 198.3019 g/mol
EINECS 250-954-9
SMILES CC(=O)OC1CCC(CC1)C(C)(C)C
InChIKey MBZRJSQZCBXRGK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4)?

4-tert-Butylcyclohexyl acetate is a colorless to light yellow liquid with a fruity odor. It has a mo...

Compound Q&A

What industries use 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4)?

4-tert-Butylcyclohexyl acetate is primarily used in the fragrance and flavor industry due to its ple...

Compound Q&A

What precautions should be taken when handling 4-tert-Butylcyclohexyl acetate (CAS: 32210-23-4)?

When handling 4-tert-Butylcyclohexyl acetate, proper personal protective equipment (PPE) should be w...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...