Compound Q&A

What industries use 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3)?

Answer

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol)
4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) is used in the pharmaceutical industry as a precursor for the synthesis of various drugs and intermediates. It is also utilized in the semiconductor industry for the production of organic semiconductors. Additionally, it finds applications in the polymer industry as a stabilizer and in the sensor industry for its unique optical and electrical properties.

About

CAS No 115-41-3
English Name 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol)
Molecular Formula C19H14O7S
Molecular Weight 386.38 g/mol
SMILES C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O
InChIKey RRRCKIRSVQAAAS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3)?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) is a white crystalline solid wit...

Compound Q&A

How is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3) typically synthesized?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) is typically synthesized by the ...

Compound Q&A

What precautions should be taken when handling 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3)?

When handling 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...