Compound Q&A

How is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3) typically synthesized?

Answer

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol)
4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) is typically synthesized by the condensation of 1,2-benzenedicarboxylic acid with 1,1-dioxido-3H-2,1-benzoxathiole-3-thione. The reaction is usually carried out in the presence of a catalyst such as a strong acid. The yield is dependent on the purity of the starting materials and the reaction conditions, with a yield of up to 85%. This compound is also synthesized via the diesterification of 1,2-benzenedicarboxylic acid with 1,1-dioxido-3H-2,1-benzoxathiole-3-thione.

About

CAS No 115-41-3
English Name 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol)
Molecular Formula C19H14O7S
Molecular Weight 386.38 g/mol
SMILES C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O
InChIKey RRRCKIRSVQAAAS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3)?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) is a white crystalline solid wit...

Compound Q&A

What industries use 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3)?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol) (CAS: 115-41-3)?

When handling 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)di(1,2-benzenediol), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...