Compound Q&A

What industries use Phenylmalonic acid (CAS: 2613-89-0)?

Answer

Phenylmalonic acid
Phenylmalonic acid (CAS: 2613-89-0) is used in a variety of industries. In pharmaceuticals, it serves as a precursor in the synthesis of certain drugs. In the polymer industry, it is used as a monomer for the production of copolymers. Additionally, it finds applications in the development of sensors, semiconductors, and as an analytical tool in analytical chemistry.

About

CAS No 2613-89-0
English Name Phenylmalonic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)O)C(=O)O
InChIKey WWYDYZMNFQIYPT-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenylmalonic acid (CAS: 2613-89-0)?

Phenylmalonic acid (CAS: 2613-89-0) is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is Phenylmalonic acid (CAS: 2613-89-0) typically synthesized?

Phenylmalonic acid (CAS: 2613-89-0) can be synthesized through various methods, including hydration ...

Compound Q&A

What precautions should be taken when handling Phenylmalonic acid (CAS: 2613-89-0)?

When handling Phenylmalonic acid (CAS: 2613-89-0), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...