Compound Q&A

How is Phenylmalonic acid (CAS: 2613-89-0) typically synthesized?

Answer

Phenylmalonic acid
Phenylmalonic acid (CAS: 2613-89-0) can be synthesized through various methods, including hydration of phenylacetaldehyde, decarboxylation of phenyl malonate, or by the Wittig reaction of phenyl methylene phosphonate. These processes often involve the use of catalysts and solvents, with high selectivity and yield being crucial for industrial applications.

About

CAS No 2613-89-0
English Name Phenylmalonic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)O)C(=O)O
InChIKey WWYDYZMNFQIYPT-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenylmalonic acid (CAS: 2613-89-0)?

Phenylmalonic acid (CAS: 2613-89-0) is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use Phenylmalonic acid (CAS: 2613-89-0)?

Phenylmalonic acid (CAS: 2613-89-0) is used in a variety of industries. In pharmaceuticals, it serve...

Compound Q&A

What precautions should be taken when handling Phenylmalonic acid (CAS: 2613-89-0)?

When handling Phenylmalonic acid (CAS: 2613-89-0), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...