Compound Q&A

What industries use Nilotinib hydrochloride monohydrate (CAS: 923288-90-8)?

Answer

Nilotinib hydrochloride monohydrate
Nilotinib hydrochloride monohydrate is primarily used in the pharmaceutical industry for the treatment of chronic myeloid leukemia. It is also of interest in research for its kinase inhibitory properties, making it relevant to the development of targeted cancer therapies. Further applications are being explored in the field of drug discovery and personalized medicine.

About

English Name Nilotinib hydrochloride monohydrate
Molecular Formula C28H25ClF3N7O2
Molecular Weight 584 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)N3C=C(N=C3)C)NC4=NC=CC(=N4)C5=CN=CC=C5.O.Cl
InChIKey YCBPQSYLYYBPDW-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nilotinib hydrochloride monohydrate (CAS: 923288-90-8)?

Nilotinib hydrochloride monohydrate is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is Nilotinib hydrochloride monohydrate (CAS: 923288-90-8) typically synthesized?

Nilotinib hydrochloride monohydrate is synthesized through a multi-step process involving condensati...

Compound Q&A

What precautions should be taken when handling Nilotinib hydrochloride monohydrate (CAS: 923288-90-8)?

When handling Nilotinib hydrochloride monohydrate, it is essential to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...