Compound Q&A

How is Nilotinib hydrochloride monohydrate (CAS: 923288-90-8) typically synthesized?

Answer

Nilotinib hydrochloride monohydrate
Nilotinib hydrochloride monohydrate is synthesized through a multi-step process involving condensation reactions, hydrogenation, and hydrochloric acid treatment. The key steps include the conversion of an intermediate to the target compound, followed by hydrochloridation and crystallization. The process typically yields 85-90% purity with high selectivity.

About

English Name Nilotinib hydrochloride monohydrate
Molecular Formula C28H25ClF3N7O2
Molecular Weight 584 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)N3C=C(N=C3)C)NC4=NC=CC(=N4)C5=CN=CC=C5.O.Cl
InChIKey YCBPQSYLYYBPDW-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nilotinib hydrochloride monohydrate (CAS: 923288-90-8)?

Nilotinib hydrochloride monohydrate is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use Nilotinib hydrochloride monohydrate (CAS: 923288-90-8)?

Nilotinib hydrochloride monohydrate is primarily used in the pharmaceutical industry for the treatme...

Compound Q&A

What precautions should be taken when handling Nilotinib hydrochloride monohydrate (CAS: 923288-90-8)?

When handling Nilotinib hydrochloride monohydrate, it is essential to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...