Compound Q&A

What precautions should be taken when handling 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9)?

Answer

5-Amino-2-naphthalenesulfonic acid
When handling 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9), it is important to wear appropriate personal protective equipment (PPE) such as gloves and safety glasses. Store in a well-ventilated area, away from strong acids and oxidizers. In case of spill, use appropriate spill cleanup procedures and consult the safety data sheet (SDS) for detailed instructions.

About

CAS No 119-79-9
English Name 5-Amino-2-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C(=C1)N
InChIKey UWPJYQYRSWYIGZ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9)?

5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9) typically synthesized?

5-Amino-2-naphthalenesulfonic acid is typically synthesized through the sulfonation of 2-naphthol fo...

Compound Q&A

What industries use 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9)?

5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9) is used in various industries including pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...