Compound Q&A

What industries use 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9)?

Answer

5-Amino-2-naphthalenesulfonic acid
5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9) is used in various industries including pharmaceuticals, dyes and pigments, and environmental monitoring. It serves as a reagent in analytical chemistry and is also used in the synthesis of other chemicals and materials.

About

CAS No 119-79-9
English Name 5-Amino-2-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C(=C1)N
InChIKey UWPJYQYRSWYIGZ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9)?

5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9) typically synthesized?

5-Amino-2-naphthalenesulfonic acid is typically synthesized through the sulfonation of 2-naphthol fo...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9)?

When handling 5-Amino-2-naphthalenesulfonic acid (CAS: 119-79-9), it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...