Compound Q&A

What industries use Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9)?

Answer

Ferrocene, (1,1-dimethylethyl)-
Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) is widely used in the pharmaceutical industry for the synthesis of metal complexes, in the polymer industry for the production of conductive polymers, in the sensor industry for gas detection, and in the semiconductor industry for electronic devices. Its unique properties make it suitable for various applications in these fields.

About

CAS No 1316-98-9
English Name Ferrocene, (1,1-dimethylethyl)-
Molecular Formula C14H18Fe
Molecular Weight 242.14 g/mol
SMILES [CH-]1C=CC=C1.CC([C-]1C=CC=C1)(C)C.[Fe+2]
InChIKey DOUYOVFHQKVSSJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9)?

Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) is a crystalline compound with a molecular weight o...

Compound Q&A

How is Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) typically synthesized?

Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) is typically synthesized through the reaction of cy...

Compound Q&A

What precautions should be taken when handling Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9)?

When handling Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...