Compound Q&A

What are the physical and chemical properties of Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9)?

Answer

Ferrocene, (1,1-dimethylethyl)-
Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) is a crystalline compound with a molecular weight of approximately 170.25 g/mol. It is insoluble in water but soluble in organic solvents like benzene, toluene, and dichloromethane. The compound is known for its strong π-complexation and reactivity with various transition metals. It is stable under normal conditions but can undergo dimerization at high temperatures or in the presence of strong oxidizing agents.

About

CAS No 1316-98-9
English Name Ferrocene, (1,1-dimethylethyl)-
Molecular Formula C14H18Fe
Molecular Weight 242.14 g/mol
SMILES [CH-]1C=CC=C1.CC([C-]1C=CC=C1)(C)C.[Fe+2]
InChIKey DOUYOVFHQKVSSJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) typically synthesized?

Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) is typically synthesized through the reaction of cy...

Compound Q&A

What industries use Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9)?

Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9) is widely used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9)?

When handling Ferrocene, (1,1-dimethylethyl)- (CAS: 1316-98-9), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...