Compound Q&A

What industries use (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9)?

Answer

(2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid
This compound is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It is also employed in the production of advanced materials, such as polymers and sensors, due to its unique chemical structure. Additionally, it has potential applications in semiconductors as a dopant or precursor.

About

CAS No 76985-10-9
English Name (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid
Molecular Formula C18H21NO4
Molecular Weight 315.37 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC2=CC=CC=C2C=C1)C(=O)O
InChIKey URKWHOVNPHQQTM-OAHLLOKOSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9)?

This compound is a white to off-white crystalline solid. Its molecular weight is approximately 344.3...

Compound Q&A

How is (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9) typically synthesized?

This compound can be synthesized via the carboxylation of 2-naphthylalanine methyl ester using sodiu...

Compound Q&A

What precautions should be taken when handling (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...