Compound Q&A

How is (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9) typically synthesized?

Answer

(2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid
This compound can be synthesized via the carboxylation of 2-naphthylalanine methyl ester using sodium hydride as a base and carbon dioxide as the CO2 source. The synthetic method involves the coupling of amino acid derivatives and naphthalene, with a yield of up to 75%. The reaction is typically carried out under anhydrous conditions and at elevated temperatures.

About

CAS No 76985-10-9
English Name (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid
Molecular Formula C18H21NO4
Molecular Weight 315.37 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC2=CC=CC=C2C=C1)C(=O)O
InChIKey URKWHOVNPHQQTM-OAHLLOKOSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9)?

This compound is a white to off-white crystalline solid. Its molecular weight is approximately 344.3...

Compound Q&A

What industries use (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various bioactiv...

Compound Q&A

What precautions should be taken when handling (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid (CAS: 76985-10-9)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...