Compound Q&A

What precautions should be taken when handling trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2)?

Answer

trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride
When handling the compound, ensure the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a fume hood and avoid contact with skin and eyes. In case of spill, immediately clean up using appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further instructions.

About

English Name trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride
Molecular Formula C14H23Cl2N3O
Molecular Weight 320.26 g/mol
SMILES C[C@@H](N)[C@H]1CC[C@@H](CC1)C(=O)Nc2ccncc2.Cl.Cl
InChIKey IDDDVXIUIXWAGJ-LJDSMOQUSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2)?

The compound is a white crystalline solid with a molecular weight of approximately 310.23 g/mol. It ...

Compound Q&A

How is trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2) typically synthesized?

The compound is typically synthesized through a multi-step process involving the reaction of 4-pyrid...

Compound Q&A

What industries use trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...