Compound Q&A

How is trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2) typically synthesized?

Answer

trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride
The compound is typically synthesized through a multi-step process involving the reaction of 4-pyridinecarboxamide with a chiral amine to form the cyclohexanecarboxamide intermediate, followed by hydrochloride salt formation. The synthesis involves the use of a chiral catalyst for high selectivity and yield.

About

English Name trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride
Molecular Formula C14H23Cl2N3O
Molecular Weight 320.26 g/mol
SMILES C[C@@H](N)[C@H]1CC[C@@H](CC1)C(=O)Nc2ccncc2.Cl.Cl
InChIKey IDDDVXIUIXWAGJ-LJDSMOQUSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2)?

The compound is a white crystalline solid with a molecular weight of approximately 310.23 g/mol. It ...

Compound Q&A

What industries use trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

Compound Q&A

What precautions should be taken when handling trans-4-[(1R)-1-Aminoethyl]-N-(4-pyridinyl)cyclohexanecarboxamide dihydrochloride (CAS: 129830-38-2)?

When handling the compound, ensure the use of personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...