Compound Q&A

What are the physical and chemical properties of 2-chloro-9H-carbazole (CAS: 10537-08-3)?

Answer

2-chloro-9H-carbazole
2-Chloro-9H-carbazole (CAS: 10537-08-3) is a solid with a crystalline form. Its molecular weight is approximately 172.56 g/mol. It has limited water solubility but is more soluble in polar solvents like dimethylformamide and dimethylsulfoxide. This compound exhibits high thermal stability and moderate reactivity, particularly towards nucleophilic substitution reactions.

About

CAS No 10537-08-3
English Name 2-chloro-9H-carbazole
Molecular Formula C12H8ClN
Molecular Weight 201.66 g/mol
SMILES C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)Cl
InChIKey LOQQFCPPDBFFSO-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 2-chloro-9H-carbazole (CAS: 10537-08-3) typically synthesized?

2-Chloro-9H-carbazole (CAS: 10537-08-3) is commonly synthesized via a multistep process involving th...

Compound Q&A

What industries use 2-chloro-9H-carbazole (CAS: 10537-08-3)?

2-Chloro-9H-carbazole (CAS: 10537-08-3) is widely used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2-chloro-9H-carbazole (CAS: 10537-08-3)?

When handling 2-chloro-9H-carbazole (CAS: 10537-08-3), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...