Compound Q&A

What industries use 3,5-bis(Trifluoromethyl) Benzoic Acid (CAS: 725-89-3)?

Answer

3,5-bis(Trifluoromethyl) Benzoic Acid
3,5-bis(Trifluoromethyl) Benzoic Acid is utilized in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the production of certain analgesics and anti-inflammatory drugs. It also finds applications in the development of novel organic materials, sensors, and semiconductor devices due to its unique electronic properties.

About

CAS No 725-89-3
English Name 3,5-bis(Trifluoromethyl) Benzoic Acid
Molecular Formula C9H4F6O2
Molecular Weight 258.12 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O
InChIKey HVFQJWGYVXKLTE-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-bis(Trifluoromethyl) Benzoic Acid (CAS: 725-89-3)?

3,5-bis(Trifluoromethyl) Benzoic Acid is a white crystalline solid at room temperature. Its molecula...

Compound Q&A

How is 3,5-bis(Trifluoromethyl) Benzoic Acid (CAS: 725-89-3) typically synthesized?

3,5-bis(Trifluoromethyl) Benzoic Acid can be synthesized via a two-step process. First, trifluoromet...

Compound Q&A

What precautions should be taken when handling 3,5-bis(Trifluoromethyl) Benzoic Acid (CAS: 725-89-3)?

When handling 3,5-bis(Trifluoromethyl) Benzoic Acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...