Compound Q&A

How is Chalcone (CAS: 94-41-7) typically synthesized?

Answer

Chalcone
Chalcone (CAS: 94-41-7) is commonly synthesized via a Claisen-Schmidt condensation of an α,β-unsaturated ketone with a phenol or aldehyde. The reaction typically requires a base like sodium hydroxide or potassium hydroxide. The yield can be improved by careful control of reaction conditions and the use of suitable solvents. The method is selective and can produce high yields of chalcone.

About

CAS No 94-41-7
English Name Chalcone
Molecular Formula C15H12O
Molecular Weight 208.26 g/mol
SMILES C1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2
InChIKey DQFBYFPFKXHELB-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chalcone (CAS: 94-41-7)?

Chalcone (CAS: 94-41-7) is a yellow crystalline compound with a molecular weight of approximately 16...

Compound Q&A

What industries use Chalcone (CAS: 94-41-7)?

Chalcone (CAS: 94-41-7) is utilized in various industries. It is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Chalcone (CAS: 94-41-7)?

When handling Chalcone (CAS: 94-41-7), appropriate personal protective equipment (PPE) should be wor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...