Compound Q&A

What are the physical and chemical properties of Chalcone (CAS: 94-41-7)?

Answer

Chalcone
Chalcone (CAS: 94-41-7) is a yellow crystalline compound with a molecular weight of approximately 162.16 g/mol. It has a high solubility in organic solvents like ethanol and chloroform. Chalcone is relatively stable under basic conditions but can undergo intramolecular condensation reactions in the presence of acid. It exhibits poor solubility in water and is weakly basic.

About

CAS No 94-41-7
English Name Chalcone
Molecular Formula C15H12O
Molecular Weight 208.26 g/mol
SMILES C1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2
InChIKey DQFBYFPFKXHELB-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Chalcone (CAS: 94-41-7) typically synthesized?

Chalcone (CAS: 94-41-7) is commonly synthesized via a Claisen-Schmidt condensation of an α,β-unsatur...

Compound Q&A

What industries use Chalcone (CAS: 94-41-7)?

Chalcone (CAS: 94-41-7) is utilized in various industries. It is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Chalcone (CAS: 94-41-7)?

When handling Chalcone (CAS: 94-41-7), appropriate personal protective equipment (PPE) should be wor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...