Compound Q&A

How is 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5) typically synthesized?

Answer

5'-Deoxy-5-fluorouridine
5'-Deoxy-5-fluorouridine (5'-DFUR) is commonly synthesized via the fluoroalkylation of 5'-deoxyuridine. The reaction typically uses fluoride sources like sodium fluoride and is catalyzed by a phase-transfer catalyst. The yield is usually around 70-80%, and the selectivity for the desired product is high. This method allows for the controlled introduction of a fluorine atom into the molecule, making it a valuable intermediate in medicinal chemistry.

About

CAS No 3094-09-5
English Name 5'-Deoxy-5-fluorouridine
Molecular Formula C9H11FN2O5
Molecular Weight 246.19 g/mol
SMILES CC1C(C(C(O1)N2C=C(C(=O)NC2=O)F)O)O
InChIKey ZWAOHEXOSAUJHY-ZIYNGMLESA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5)?

5'-Deoxy-5-fluorouridine (5'-DFUR) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5)?

5'-Deoxy-5-fluorouridine (5'-DFUR) is primarily used in the pharmaceutical industry due to its poten...

Compound Q&A

What precautions should be taken when handling 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5)?

When handling 5'-Deoxy-5-fluorouridine (5'-DFUR), it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...