Compound Q&A

What are the physical and chemical properties of 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5)?

Answer

5'-Deoxy-5-fluorouridine
5'-Deoxy-5-fluorouridine (5'-DFUR) is a crystalline compound with a molecular weight of approximately 193.14 g/mol. It has a solubility of about 10 mg/mL in water and is relatively stable in acidic and neutral solutions. However, it is susceptible to hydrolysis in basic conditions. The compound shows limited reactivity towards nucleophilic substitutions and can be used as a fluorinated analog in various chemical reactions.

About

CAS No 3094-09-5
English Name 5'-Deoxy-5-fluorouridine
Molecular Formula C9H11FN2O5
Molecular Weight 246.19 g/mol
SMILES CC1C(C(C(O1)N2C=C(C(=O)NC2=O)F)O)O
InChIKey ZWAOHEXOSAUJHY-ZIYNGMLESA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5) typically synthesized?

5'-Deoxy-5-fluorouridine (5'-DFUR) is commonly synthesized via the fluoroalkylation of 5'-deoxyuridi...

Compound Q&A

What industries use 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5)?

5'-Deoxy-5-fluorouridine (5'-DFUR) is primarily used in the pharmaceutical industry due to its poten...

Compound Q&A

What precautions should be taken when handling 5'-Deoxy-5-fluorouridine (CAS: 3094-09-5)?

When handling 5'-Deoxy-5-fluorouridine (5'-DFUR), it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...