Compound Q&A

What industries use D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6)?

Answer

D-3-(2-Naphthyl) Alanine
D-3-(2-Naphthyl) Alanine is primarily used in the pharmaceutical industry for the synthesis of novel drugs and in sensors for detecting specific compounds. It is also utilized in the polymer industry for enhancing the properties of polymers, particularly in biomedical applications. Additionally, it finds applications in the semiconductor industry for the development of new materials with tailored properties.

About

CAS No 76985-09-6
English Name D-3-(2-Naphthyl) Alanine
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)CC(C(=O)O)N
InChIKey JPZXHKDZASGCLU-GFCCVEGCSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6)?

D-3-(2-Naphthyl) Alanine is an organic compound with a molecular weight of approximately 237.24 g/mo...

Compound Q&A

How is D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6) typically synthesized?

D-3-(2-Naphthyl) Alanine is typically synthesized via a multistep process involving the coupling of ...

Compound Q&A

What precautions should be taken when handling D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6)?

When handling D-3-(2-Naphthyl) Alanine, it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...